p-Coumaric acid glucoside
p-Coumaric acid glucoside
|
Names |
IUPAC name
(E)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
Other names
p-Coumaric acid 4-O-glucoside |
Identifiers |
|
14364-05-7 |
ChemSpider |
8016010 |
Jmol interactive 3D |
Image |
PubChem |
9840292 |
InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBSA-N InChI=1/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBBA
|
C1=CC(=CC=C1/C=C/C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
|
Properties |
|
C15H18O8 |
Molar mass |
326.29 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
p-Coumaric acid glucoside is a hydroxycinnamic acid, an organic compound found in commercial breads containing flaxseed.[1]
References
- ↑ Phenolic glucosides in bread containing flaxseed. C. Strandås, A. Kamal-Eldin, R. Andersson and P. Åman, Food Chemistry, Volume 110, Issue 4, 15 October 2008, Pages 997–999, doi:10.1016/j.foodchem.2008.02.088
External links
|
---|
| Aglycones | Precursor | |
---|
| Monohydroxycinnamic acids (Coumaric acids) | |
---|
| | |
---|
| Trihydroxycinnamic acids | |
---|
| O-methylated forms | |
---|
| others | |
---|
|
---|
| Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
| esters of shikimic acid | |
---|
|
---|
| Glycosides | |
---|
|
---|
| Tartaric acid esters | |
---|
| Other esters with caffeic acid | |
---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
---|
|
---|
| Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
---|
| Trimers | |
---|
| Tetramers | |
---|
|
---|
| Conjugates with coenzyme A (CoA) | |
---|
|