Viscumamide
Viscumamide
|
Names |
IUPAC name
Cyclo(isoleucylleucylisoleucylleucylleucyl) |
Identifiers |
ChemSpider |
486785 |
InChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) Key: KACXIDDXMHJUSH-UHFFFAOYSA-N InChI=1/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) Key: KACXIDDXMHJUSH-UHFFFAOYAM
|
Jmol-3D images |
Image |
PubChem |
559969 |
O=C1NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1C(C)CC)CC(C)C)C(C)CC)CC(C)C)CC(C)C
|
Properties |
Molecular formula |
C30H55N5O5 |
Molar mass |
565.79 g·mol−1 |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Infobox references |
|
|
Viscumamide is a cyclic peptide isolated from endophytic fungi of mangrove.[1]
References
- ↑ Guo, ZY; Huang, ZJ; Wen, L; Wan, Q; Liu, F; She, ZG; Lin, YC; Zhou, SN (2007). "The metabolites of cyclic peptides from three endophytic mangrove fungi". Zhong yao cai = Zhongyaocai = Journal of Chinese medicinal materials 30 (12): 1526–9. PMID 18422185.