Vat Green 9
Vat Green 9
 |
| Names |
| IUPAC name
16-Nitroanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione |
| Other names
16-Nitroviolanthrene-5,10-dione |
| Identifiers |
| |
128-60-9 |
| ChemSpider |
60530 |
InChI=1S/C34H15NO4/c36-33-21-7-3-1-5-16(21)18-9-12-23-28-19(10-13-24(33)29(18)28)20-11-14-25-30-26(15-27(35(38)39)31(23)32(20)30)17-6-2-4-8-22(17)34(25)37/h1-15H
Key: LNNHYUOWYOSHPH-UHFFFAOYSA-N InChI=1/C34H15NO4/c36-33-21-7-3-1-5-16(21)18-9-12-23-28-19(10-13-24(33)29(18)28)20-11-14-25-30-26(15-27(35(38)39)31(23)32(20)30)17-6-2-4-8-22(17)34(25)37/h1-15H
Key: LNNHYUOWYOSHPH-UHFFFAOYAA
|
| Jmol-3D images |
Image |
| PubChem |
67187 |
[O-][N+](=O)c3c2c1ccc9c7c1c(c6c2c5c(c3)c4ccccc4C(=O)c5cc6)ccc7C(=O)c8ccccc89
|
| Properties |
| Molecular formula |
C34H15NO4 |
| Molar mass |
501.49 g·mol−1 |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
|
| Infobox references |
|
|
Vat Green 9 is a type of vat dye. The molecular structure of Vat Green 9 is based on violanthrone.[1]
References
|
|---|
| | Techniques | | |
|---|
| | Types of dyes | |
|---|
| | Traditional textile dyes | |
|---|
| | History | |
|---|
| | Craft dyes | |
|---|
| | Reference | |
|---|
|
