Trifucol

Trifucol
Identifiers

InChI InChI=1S/C18H14O9/c19-6-1-8(21)14(9(22)2-6)16-12(25)5-13(26)17(18(16)27)15-10(23)3-7(20)4-11(15)24/h1-5,19-27H Key: COTZPIUJHGYKAQ-UHFFFAOYSA-N
Jmol-3D images	Image
SMILES C1=C(C(=C(C(=C1O)C2=C(C=C(C=C2O)O)O)O)C3=C(C=C(C=C3O)O)O)O
Properties
Chemical formula	C₁₈H₁₄O₉
Molar mass	374.29 g/mol
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa)
Infobox references

Trifucol is a phlorotannin found in the brown algae Scytothamnus australis and Analipus japonicus.

References

Types of phlorotannins (tannins in brown algae)

Monomer	Phloroglucinol

Fucols	Difucol Trifucol Tetrafucol A Tetrafucol B cis-Pentafucol A

Phlorethols	Diphlorethol and diphlorethol A Triphloroethol A Tetraphlorethol A, B, C and E Pentaphlorethol-B Hexaphlorethol-A

Fucophlorethols	Fucophlorethol A and B Fucodiphlorethol A, D and G Fucotriphlorethol-B, G and H Fucotetraphlorethol-B, J and K Fucopentaphlorethol-E Bisfucotriphlorethol-A Bisfucotetraphlorethol-A Bisfucopentaphlorethol-A and B Bisfucoheptaphlorethol-A Difucophlorethol-A Difucofucotriphlorethol-A and B Difucofucotetraphlorethol-A Terfucopentaphlorethol-A Terfucohexaphlorethol-A and B Terfucoheptaphlorethol-A

Fuhalols	Bifuhalol Trifuhalol A Tetrafuhalol A

Isofuhalols	Tetraisofuhalol

Eckols	Dieckol Eckol Eckstolonol Phlorofucofuroeckol A and B 2-Phloroeckol 3-Phloroeckol 6,6'-Bieckol 7-Phloroeckol 8,4"'-Dieckol 8,8′-Bieckol

Halogenated phlorotannins	Bromotriphlorethol A1