Thunberginol G
Thunberginol G
 |
| Identifiers |
| |
80394-88-3  Y |
| Jmol-3D images |
Image |
O=C3c1c(cccc1O)CC(O3)c(cc2O)ccc2O
|
| Properties |
| |
C15H12O5 |
| Molar mass |
272.25 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Y verify (what is: Y/ N?) |
| Infobox references |
|
|
Thunberginol G is an dihydroisocoumarin found in Hydrangeae Dulcis Folium, the processed leaves of Hydrangea macrophylla var. thunbergii.[1]
References
- ↑ Yoshikawa, M.; Uchida, E.; Chatani, N.; Kobayashi, H.; Naitoh, Y.; Okuno, Y.; Matsuda, H.; Yamahara, J.; Murakami, N. (1992). "Thunberginols C, D, and E, New Antiallergic and Antimicrobial Dihydroisocoumarins, and Thunberginol G 3'-O-Glucoside and (-)-Hydrangenol 4'-O-Glucoside, New Dihydroisocoumarin Glycosides, from Hydrangeae Dulcis Folium" (PDF). Chemical and Pharmaceutical Bulletin 40 (12): 3352–3354. doi:10.1248/cpb.40.3352. PMID 1363465.