Pratol
Pratol
![Chemical structure of pratol.](../I/m/Pratol.png) |
Names |
IUPAC name
7-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
Other names
7-Hydroxy-4-methoxyflavone |
Identifiers |
|
487-24-1 |
ChemSpider |
4478714 |
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)15-9-14(18)13-7-4-11(17)8-16(13)20-15/h2-9,17H,1H3 Key: SQVXWIUVAILQRH-UHFFFAOYSA-N InChI=1/C16H12O4/c1-19-12-5-2-10(3-6-12)15-9-14(18)13-7-4-11(17)8-16(13)20-15/h2-9,17H,1H3 Key: SQVXWIUVAILQRH-UHFFFAOYAR
|
Jmol-3D images |
Image |
PubChem |
5320693 |
COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)O
|
Properties |
|
C16H12O4 |
Molar mass |
268.26 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Infobox references |
|
|
Pratol is an O-methylated flavone. It can be found in Trifolium pratense.
References
|
---|
| Aglycones | Monohydroxyflavone | |
---|
| Dihydroxyflavones | |
---|
| Trihydroxyflavones | |
---|
| Tetrahydroxyflavones | |
---|
| Pentahydroxyflavones | |
---|
| O-methylated flavones | |
---|
|
---|
| Glycosides | of apigenin | |
---|
| of baicalein | |
---|
| of hypolaetin |
- Hypolaetin 8-glucoside
- Hypolaetin 8-glucuronide
|
---|
| of luteolin | |
---|
|
---|
| Acetylated |
- Artocarpetin A
- Artoindonesianin P
|
---|
| Sulfated glycosides | |
---|
| Polymers | |
---|
| Drugs | |
---|
|