JWH-057
JWH-057
|
Systematic (IUPAC) name |
---|
(6aR,10aR)-3-(1,1-dimethylheptyl)-6a,7,10,10a-tetrahydro-6,6,9-trimethyl-6H-Dibenzo[b,d]pyran |
Clinical data |
---|
Identifiers |
---|
|
105823-04-9 Y |
---|
ChemSpider |
114395 |
---|
Chemical data |
---|
Formula |
C25H38O |
---|
|
354.57 g/mol |
---|
SMILES
- CCCCCCC(C)(C)C1=CC2=C(C=C1)[C@@H]3CC(=CC[C@H]3C(O2)(C)C)C
|
InChI=1S/C25H38O/c1-7-8-9-10-15-24(3,4)19-12-13-20-21-16-18(2)11-14-22(21)25(5,6)26-23(20)17-19/h11-13,17,21-22H,7-10,14-16H2,1-6H3/t21-,22+/m0/s1
Key:JEEFMLVJZKFOFV-FCHUYYIVSA-N
|
JWH-057, also known as deoxy-Δ8-THC-DMH, is a selective cannabinoid ligand, with a binding affinity of Ki = 2.9 ± 1.6 nM for the CB2 subtype, and Ki = 23 ± 7 nM for CB1.[1]
See also
References
- ↑ Huffman JW, Yu S, Showalter V, Abood ME, Wiley JL, Compton DR, Martin BR, Bramblett RD, Reggio PH (1996). "Synthesis and Pharmacology of a Very Potent Cannabinoid Lacking a Phenolic Hydroxyl with High Affinity for the CB2 Receptor". J. Med. Chem. 39 (20): 3875–3877. doi:10.1021/JM960394Y.
|
---|
| Phytocannabinoids | |
---|
| Cannabinoid metabolites | |
---|
| Endogenous cannabinoids | |
---|
| Synthetic cannabinoid receptor agonists | Classical cannabinoids (Dibenzopyrans) | |
---|
| Nonclassical cannabinoids | |
---|
| Benzoylindoles | |
---|
| Naphthoylindoles | |
---|
| Naphthoylindazoles | |
---|
| Pyrrolobenzoxazines | |
---|
| Naphthylmethylindoles | |
---|
| Phenylacetylindoles | |
---|
| Indole-3-carboxamides | |
---|
| Indole-3-carboxylates | |
---|
| Indazole-3-carboxamides | |
---|
| Naphthoylpyrroles | |
---|
| Eicosanoids | |
---|
| Others | |
---|
|
---|
| Allosteric modulators of cannabinoid receptors | |
---|
| Endocannabinoid activity enhancers | |
---|
| Cannabinoid receptor antagonists and inverse agonists | |
---|
|