JWH-048
JWH-048
|
Systematic (IUPAC) name |
---|
(1-pentyl-2-methyl-1H-indol-3-yl)(7-methyl-1-naphthalenyl)methanone |
Clinical data |
---|
Identifiers |
---|
|
316189-66-9 |
---|
ChemSpider |
9455134 |
---|
Chemical data |
---|
Formula |
C26H27NO |
---|
|
369.50 g/mol |
---|
SMILES
- CCCCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=C3C=C(C=C4)C)C
|
InChI=1S/C26H27NO/c1-4-5-8-16-27-19(3)25(22-11-6-7-13-24(22)27)26(28)21-12-9-10-20-15-14-18(2)17-23(20)21/h6-7,9-15,17H,4-5,8,16H2,1-3H3
Key:HSGMJSSWGKDWNA-UHFFFAOYSA-N
|
JWH-048 is a selective cannabinoid ligand, with a bindining affinity of Ki = 0.5 ± 0.1 nM for the CB2 subtype, and more than 22 times selectivity over the CB1.[1]
See also
References
- ↑ Aung MM, Griffin G, Huffman JW, Wu M-J, Keel C, Yang B, Showalter VM, Abood ME, Martin BR (2000). "Influence of the N-1 alkyl chain length of cannabimimetic indoles upon CB1 and CB2 receptor binding". Drug and Alcohol Dependence 60 (2): 133–40. doi:10.1016/S0376-8716(99)00152-0. PMID 10940540.
|
---|
| Phytocannabinoids | |
---|
| Cannabinoid metabolites | |
---|
| Endogenous cannabinoids | |
---|
| Synthetic cannabinoid receptor agonists | Classical cannabinoids (Dibenzopyrans) | |
---|
| Nonclassical cannabinoids | |
---|
| Benzoylindoles | |
---|
| Naphthoylindoles | |
---|
| Naphthoylindazoles | |
---|
| Pyrrolobenzoxazines | |
---|
| Naphthylmethylindoles | |
---|
| Phenylacetylindoles | |
---|
| Indole-3-carboxamides | |
---|
| Indole-3-carboxylates | |
---|
| Indazole-3-carboxamides | |
---|
| Naphthoylpyrroles | |
---|
| Eicosanoids | |
---|
| Others | |
---|
|
---|
| Allosteric modulators of cannabinoid receptors | |
---|
| Endocannabinoid activity enhancers | |
---|
| Cannabinoid receptor antagonists and inverse agonists | |
---|
|