Iditol
D-Iditol
![](../I/m/Iditol.png) |
Names |
IUPAC name
(2R,3S,4S,5R)-Hexane-1,2,3,4,5,6-hexol |
Identifiers |
ChemSpider |
81747 N |
InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m1/s1 NKey: FBPFZTCFMRRESA-ZXXMMSQZSA-N NInChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m1/s1 Key: FBPFZTCFMRRESA-ZXXMMSQZBT
|
Jmol-3D images |
Image |
PubChem |
90540 |
O[C@@H]([C@H](O)CO)[C@@H](O)[C@H](O)CO
|
Properties |
|
C6H14O6 |
Molar mass |
182.172g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
N verify (what is: Y/ N?) |
Infobox references |
|
|
Iditol is a sugar alcohol which accumulates in galactokinase deficiency.
See also
|
---|
| Fructose | |
---|
| Galactose | |
---|
| Mannose | |
---|
| |
---|
| Description |
- Metabolism
- Enzymes and pathways: citric acid cycle
- pentose phosphate
- glycoproteins
- glycosaminoglycans
- phospholipid
- cholesterol and steroid
- sphingolipids
- eicosanoids
- amino acid
- urea cycle
- nucleotide
|
---|
| Disorders |
- Citric acid cycle and electron transport chain
- Glycoprotein
- Proteoglycan
- Fatty-acid
- Phospholipid
- Cholesterol and steroid
- Eicosanoid
- Amino acid
- Purine-pyrimidine
- Heme metabolism
- Symptoms and signs
|
---|
| Treatment | |
---|
|
|
|
---|
| 1-carbon | |
---|
| 2-carbon | |
---|
| 3-carbon | |
---|
| 4-carbon | |
---|
| 5-carbon | |
---|
| 6-carbon | |
---|
| 7-carbon | |
---|
| Deoxy sugar alcohols | |
---|
| Cyclic sugar alcohols | |
---|
| Glycylglycitols | |
---|
|