Hydroxymethylbilane
Hydroxymethylbilane
|
Identifiers |
|
73023-76-4 |
ChEBI |
CHEBI:16645 Y |
ChEMBL |
ChEMBL273676 Y |
ChemSpider |
767 Y |
InChI=1S/C40H46N4O17/c45-17-32-25(12-40(60)61)21(4-8-36(52)53)29(44-32)15-31-24(11-39(58)59)20(3-7-35(50)51)28(43-31)14-30-23(10-38(56)57)19(2-6-34(48)49)27(42-30)13-26-22(9-37(54)55)18(16-41-26)1-5-33(46)47/h16,41-45H,1-15,17H2,(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61) YKey: WDFJYRZCZIUBPR-UHFFFAOYSA-N YInChI=1/C40H46N4O17/c45-17-32-25(12-40(60)61)21(4-8-36(52)53)29(44-32)15-31-24(11-39(58)59)20(3-7-35(50)51)28(43-31)14-30-23(10-38(56)57)19(2-6-34(48)49)27(42-30)13-26-22(9-37(54)55)18(16-41-26)1-5-33(46)47/h16,41-45H,1-15,17H2,(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61) Key: WDFJYRZCZIUBPR-UHFFFAOYAI
|
Jmol-3D images |
Image |
MeSH |
hydroxymethylbilane |
PubChem |
788 |
O=C(O)Cc1c(cnc1Cc2c(c(c(n2)Cc3nc(c(c3CCC(=O)O)CC(=O)O)Cc4c(c(c(n4)CO)CC(=O)O)CCC(=O)O)CC(=O)O)CCC(=O)O)CCC(=O)O
|
Properties |
|
C40H46N4O17 |
Molar mass |
854.81 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Y verify (what is: Y/N?) |
Infobox references |
|
|
Hydroxymethylbilane (HMB), also known as preuroporphyrinogen, is a molecule involved in the metabolism of porphyrin. In the third step, it is generated by the enzyme porphobilinogen deaminase, and in the next step the enzyme uroporphyrinogen III synthase converts it into uroporphyrinogen III.
In general, defects of heme synthesis after formation of HMB lead to photosensitivity.
|
---|
| Porphyrin biosynthesis | early mitochondrial: | |
---|
| cytosolic: | |
---|
| late mitochondrial: | |
---|
|
---|
| Heme degradation and excretion | Breakdown of heme | |
---|
| Intestine, excretion in feces | |
---|
| Kidney, excretion in urine | |
---|
|
---|
| |
---|
| Description |
- Immune system
- Cells
- Physiology
- coagulation
- proteins
- granule contents
- colony-stimulating
- heme and porphyrin
|
---|
| Disease |
- Red blood cell
- Monocyte and granulocyte
- Neoplasms and cancer
- Histiocytosis
- Symptoms and signs
- Blood tests
|
---|
| Treatment |
- Transfusion
- Drugs
- thrombosis
- bleeding
- other
|
---|
|
|