Gnetucleistol E
Gnetucleistol E
![Chemical structure of gnetucleistol E](../I/m/Gnetucleistol_E.png) |
Names |
IUPAC name
5-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol |
Other names
3-methoxy-isorhapontigenin |
Identifiers |
|
629643-27-2 |
ChemSpider |
23333675 |
InChI=1S/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+ Key: WHKSEHKYYXHCTA-ONEGZZNKSA-N InChI=1/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+ Key: WHKSEHKYYXHCTA-ONEGZZNKBB
|
Jmol-3D images |
Image |
PubChem |
53395175 |
COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)O)O)OC
|
Properties |
|
C16H16O4 |
Molar mass |
272.29 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Infobox references |
|
|
Gnetucleistol E is a stibenoid found in the Chinese herb Gnetum cleistostachyum.[1]
References
- ↑ Stilbenes from Gnetum cleistostachyum. Yao Chun-Suo, Lin Mao, Liu Xin and Wangy Ying-Hong, Huaxue xuebao, 2003, vol. 61, no 8, pages 1331-1334,
INIST:15332136
Hydroxystilbenes and their glycosides (monomeric forms) |
---|
| Dihydroxylated | |
---|
| Trihydroxylated | |
---|
| Tetrahydroxylated | |
---|
| O-methylated | |
---|
| carboxylated | |
---|
| other acylations | |
---|
| Glycosides | | | of resveratrol | |
---|
| of rhapontigenin |
- Rhapontigenin 3-O-rutinoside
- 4'-Methoxy-(E)-resveratrol 3-O-rutinoside
- Rhaponticin (Rhapontigenin glucoside)
|
---|
|
|
---|
| Oligomeric forms | |
---|
|