Gnetucleistol D
Gnetucleistol D
|
Names |
Other names
2-methoxyoxyresveratrol |
Identifiers |
|
629643-26-1 |
ChemSpider |
23279071 |
InChI=1S/C15H14O4/c1-19-15-9-12(16)5-4-11(15)3-2-10-6-13(17)8-14(18)7-10/h2-9,16-18H,1H3/b3-2+ Key: CFQSTARVCGBYNJ-NSCUHMNNSA-N InChI=1/C15H14O4/c1-19-15-9-12(16)5-4-11(15)3-2-10-6-13(17)8-14(18)7-10/h2-9,16-18H,1H3/b3-2+ Key: CFQSTARVCGBYNJ-NSCUHMNNBH
|
Jmol-3D images |
Image |
PubChem |
44419358 |
COc2cc(O)ccc2/C=C/c1cc(O)cc(O)c1
|
Properties |
|
C15H14O4 |
Molar mass |
258.27 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Infobox references |
|
|
Gnetucleistol D is a stilbenoid found in the Chinese herb Gnetum cleistostachyum.[1]
References
- ↑ Stilbenes from Gnetum cleistostachyum. Yao Chun-Suo, Lin Mao, Liu Xin and Wangy Ying-Hong, Huaxue xuebao, 2003, vol. 61, no 8, pages 1331-1334,
INIST:15332136
Hydroxystilbenes and their glycosides (monomeric forms) |
---|
| Dihydroxylated | |
---|
| Trihydroxylated | |
---|
| Tetrahydroxylated | |
---|
| O-methylated | |
---|
| carboxylated | |
---|
| other acylations | |
---|
| Glycosides | | | of resveratrol | |
---|
| of rhapontigenin |
- Rhapontigenin 3-O-rutinoside
- 4'-Methoxy-(E)-resveratrol 3-O-rutinoside
- Rhaponticin (Rhapontigenin glucoside)
|
---|
|
|
---|
| Oligomeric forms | |
---|
|