Ethylhexyl triazone
Ethylhexyl triazone
 |
| Names |
| IUPAC name
4-[[4,6-bis[[4-(2-ethylhexoxy-oxomethyl)phenyl]amino]-1,3,5-triazin-2-yl]amino]benzoic acid 2-ethylhexyl ester |
| Other names
Octyl triazone |
| Identifiers |
| |
88122-99-0  Y |
| ChemSpider |
140022 Y |
InChI=1S/C48H66N6O6/c1-7-13-16-34(10-4)31-58-43(55)37-19-25-40(26-20-37)49-46-52-47(50-41-
27-21-38(22-28-41)44(56)59-32-35(11-5)17-14-8-2)54-48(53-46)51-42-29-23-39(24-30-42)45(57)60-33-
36(12-6)18-15-9-3/h19-30,34-36H,7-18,31-33H2,1-6H3,(H3,49,50,51,52,53,54) YKey: JGUMTYWKIBJSTN-UHFFFAOYSA-N YInChI=1/C48H66N6O6/c1-7-13-16-34(10-4)31-58-43(55)37-19-25-40(26-20-37)49-46-52-47(50-41-27-2
1-38(22-28-41)44(56)59-32-35(11-5)17-14-8-2)54-48(53-46)51-42-29-23-39(24-30-42)45(57)60-33-36(12-
6)18-15-9-3/h19-30,34-36H,7-18,31-33H2,1-6H3,(H3,49,50,51,52,53,54) Key: JGUMTYWKIBJSTN-UHFFFAOYAV
|
| Jmol-3D images |
Image |
| PubChem |
159201 |
O=C(OCC(CC)CCCC)c1ccc(cc1)Nc2nc(nc(n2)Nc3ccc(C(=O)OCC(CC)CCCC)cc3)Nc4ccc(C(=O)OCC(CC)CCCC)cc4
|
| Properties |
| |
C48H66N6O6 |
| Molar mass |
823.07 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Y verify (what is: Y/ N?) |
| Infobox references |
|
|
Ethylhexyl triazone (INCI) is an organic compound used in sunscreens to absorb UVB radiation. It is marketed as Uvinul T 150 by BASF. Ethylhexyl triazone has an absorption maximum of 314 nm.[1]
References
- ↑ UV Absorber Portfolio Performance Data and Regulatory Status, cosmetics.basf.de
|
|---|
|
- UVA: 400–315 nm
- UVB: 315–290 nm
- chemical agents unless otherwise noted
| | | UVA filters | |
|---|
| | UVB filters | |
|---|
| | UVA+UVB filters | |
|---|
| |
|