Ermanin
Ermanin
|
Names |
IUPAC name
5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)chromen-4-one |
Other names
3,4'-Dimethoxychrysin Kaempferol-3,4'-dimethylether Kaempferol 3,4'-di-O-methyl ether 5,7-Dihydroxy-3,4'-dimethoxyflavone 5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-benzopyrone |
Identifiers |
|
20869-95-8 Y= |
ChemSpider |
4508982 N |
InChI=1S/C17H14O6/c1-21-11-5-3-9(4-6-11)16-17(22-2)15(20)14-12(19)7-10(18)8-13(14)23-16/h3-8,18-19H,1-2H3 NKey: RJCJVIFSIXKSAH-UHFFFAOYSA-N NInChI=1/C17H14O6/c1-21-11-5-3-9(4-6-11)16-17(22-2)15(20)14-12(19)7-10(18)8-13(14)23-16/h3-8,18-19H,1-2H3 Key: RJCJVIFSIXKSAH-UHFFFAOYAU
|
Jmol-3D images |
Image |
PubChem |
5352001 |
COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC
|
Properties |
|
C17H14O6 |
Molar mass |
314.28 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
N verify (what is: Y/N?) |
Infobox references |
|
|
Ermanin is an O-methylated flavonol. It was isolated from Tanacetum microphyllum.[1]
References
Flavonols and their conjugates |
---|
| Backbone | |
---|
| Flavonols | Aglycones | |
---|
| Conjugates | | |
---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
---|
| | |
---|
| | |
---|
|
---|
|
---|
| O-Methylated flavonols | Aglycones | |
---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
---|
|
---|
|
---|
| Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
---|
| Glycosides | |
---|
|
---|
| Pyranoflavonols | |
---|
| Furanoflavonols | |
---|
| Semisynthetic | |
---|
|