Eoxin D4
Eoxin D4
 |
| Names |
| IUPAC name
S-[(6S,7R,8E,10E,12Z,15Z)-19-Carboxy-6-hydroxy-8,10,12,15-nonadecatetraen-7-yl]-L-cysteinylglycine |
| Other names
14,15-Leukotriene D4; 14,15-LTD4 |
| Identifiers |
InChI=1S/C25H40N2O6S/c1-2-3-12-15-21(28)22(34-19-20(26)25(33)27-18-24(31)32)16-13-10-8-6-4-5-7-9-11-14-17-23(29)30/h4,6-10,13,16,20-22,28H,2-3,5,11-12,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b6-4-,9-7-,10-8+,16-13+/t20-,21-,22+/m0/s1
Key: BUTLPEVGZIRJOA-SPCGXPCUSA-N
|
| Jmol-3D images |
Image |
| PubChem |
42607304 |
CCCCC[C@@H]([C@@H](/C=C/C=C/C=C\C/C=C\CCCC(=O)O)SC[C@@H](C(=O)NCC(=O)O)N)O
|
| Properties |
| Molecular formula |
C25H40N2O6S |
| Molar mass |
496.66 g·mol−1 |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
|
| Infobox references |
|
|
Eoxin D4, also known as 14,15-leukotriene D4, is an eoxin.
|
|---|
| | Precursor | |
|---|
| | Prostanoids | |
|---|
| | Leukotrienes (LT) | |
|---|
| | Eoxins (EX) | | Precursor |
- Arachidonic acid 15-hydroperoxide
|
|---|
| | Eoxins | |
|---|
|
|---|
| | Nonclassic | |
|---|
| | By function |
- platelets: induce
- inhibit
- leukocytes: induce
- inhibit
|
|---|
| |
|---|
| | Description |
- Metabolism
- Enzymes and pathways: citric acid cycle
- pentose phosphate
- glycoproteins
- glycosaminoglycans
- phospholipid
- cholesterol and steroid
- sphingolipids
- eicosanoids
- amino acid
- urea cycle
- nucleotide
|
|---|
| | Disorders |
- Citric acid cycle and electron transport chain
- Glycoprotein
- Proteoglycan
- Fatty-acid
- Phospholipid
- Cholesterol and steroid
- Eicosanoid
- Amino acid
- Purine-pyrimidine
- Heme metabolism
- Symptoms and signs
|
|---|
| | Treatment | |
|---|
|
|---|
| | Carbohydrates |
- Alcohols
- Glycoproteins
- Glycosides
|
|---|
| | Lipids |
- Eicosanoids
- Fatty acids
- Glycerides
- Phospholipids
- Sphingolipids
- Steroids
|
|---|
| | Nucleic acids | |
|---|
| | Proteins | |
|---|
| | Other |
- Tetrapyrroles
- intermediates
|
|---|
|
|