Difucol

Difucol
Names

IUPAC name 2-(2,4,6-trihydroxyphenyl)benzene-1,3,5-triol
Identifiers
CAS Registry Number	4371-20-4
InChI InChI=1S/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYSA-N InChI=1/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H Key: PHDPNHJFOMABOA-UHFFFAOYAY
Jmol-3D images	Image
SMILES Oc1cc(O)cc(O)c1-c2c(O)cc(O)cc2O
Properties
Chemical formula	C₁₂H₁₀O₆
Molar mass	250.20 g/mol
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa)
Infobox references

Difucol is a phlorotannin found in the brown algae Analipus japonicus and Cystophora retroflexa.

References

Types of phlorotannins (tannins in brown algae)

Monomer	Phloroglucinol

Fucols	Difucol Trifucol Tetrafucol A Tetrafucol B cis-Pentafucol A

Phlorethols	Diphlorethol and diphlorethol A Triphloroethol A Tetraphlorethol A, B, C and E Pentaphlorethol-B Hexaphlorethol-A

Fucophlorethols	Fucophlorethol A and B Fucodiphlorethol A, D and G Fucotriphlorethol-B, G and H Fucotetraphlorethol-B, J and K Fucopentaphlorethol-E Bisfucotriphlorethol-A Bisfucotetraphlorethol-A Bisfucopentaphlorethol-A and B Bisfucoheptaphlorethol-A Difucophlorethol-A Difucofucotriphlorethol-A and B Difucofucotetraphlorethol-A Terfucopentaphlorethol-A Terfucohexaphlorethol-A and B Terfucoheptaphlorethol-A

Fuhalols	Bifuhalol Trifuhalol A Tetrafuhalol A

Isofuhalols	Tetraisofuhalol

Eckols	Dieckol Eckol Eckstolonol Phlorofucofuroeckol A and B 2-Phloroeckol 3-Phloroeckol 6,6'-Bieckol 7-Phloroeckol 8,4"'-Dieckol 8,8′-Bieckol

Halogenated phlorotannins	Bromotriphlorethol A1