Coutaric acid
Coutaric acid
|
Names |
IUPAC name
(2R,3R)-2-Hydroxy-3-(((E)-3-(4-hydroxyphenyl)acryloyl)oxy)succinic acid |
Other names
trans-coutaric acid cis-coutaric acid trans-p-Coumaroyltartaric acid cis-p-coumaroyl-(+)-tartaric acid trans-p-coumaroyl-(+)-tartaric acid cis-Coumaroyl tartaric acidbr>trans-Coumaroyl tartaric acid |
Identifiers |
|
27174-07-8 Y |
ChEBI |
CHEBI:77439 N |
ChemSpider |
26325199 N |
InChI=1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 NKey: INYJZRKTYXTZHP-NNPIPJJVSA-N NInChI=1/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 Key: INYJZRKTYXTZHP-NNPIPJJVBX
|
Jmol-3D images |
Image |
c1cc(ccc1/C=C/C(=O)O[C@H]([C@H](C(=O)O)O)C(=O)O)O
|
Properties |
Molecular formula |
C13H12O8 |
Molar mass |
296.23 g·mol−1 |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
N verify (what is: Y/N?) |
Infobox references |
|
|
Coutaric acid is an hydroxycinnamoyltartaric acid found in wine, pomace[1] and grape.[2] It is an ester formed from coumaric acid and tartaric acid.
References
- ↑ Maier, T.; Sanzenbacher, S.; Kammerer, D. R.; Berardini, N.; Conrad, J. R.; Beifuss, U.; Carle, R.; Schieber, A. (2006). "Isolation of hydroxycinnamoyltartaric acids from grape pomace by high-speed counter-current chromatography". Journal of Chromatography A 1128 (1–2): 61–67. doi:10.1016/j.chroma.2006.06.082. PMID 16860334.
- ↑ Singleton, V. L.; Zaya, J.; Trousdale, E. K. (1986). "Caftaric and coutaric acids in fruit of Vitis". Phytochemistry 25 (9): 2127. doi:10.1016/0031-9422(86)80078-4.
|
---|
| Aglycones | Precursor | |
---|
| Monohydroxycinnamic acids (Coumaric acids) | |
---|
| | |
---|
| Trihydroxycinnamic acids |
- 3,4,5-Trihydroxycinnamic acid
- 3,4,6-Trihydroxycinnamic acid
|
---|
| O-methylated forms | |
---|
| others | |
---|
|
---|
| Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
| esters of shikimic acid | |
---|
|
---|
| Glycosides | |
---|
|
---|
| Tartaric acid esters | |
---|
| Other esters with caffeic acid | |
---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
---|
|
---|
| Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
---|
| Trimers | |
---|
| Tetramers | |
---|
|
---|
| Conjugates with coenzyme A | |
---|
|