Chlorophyll d
Chlorophyll d
|
Identifiers |
|
519-63-1 N |
ChEBI |
CHEBI:38199 Y |
ChemSpider |
16736116 N |
InChI=1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1 YKey: QXWRYZIMSXOOPY-SKHCYZARSA-M YInChI=1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1
|
Jmol-3D images |
Image |
PubChem |
6449882 16070025 |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCC(\C)=C\COC(=O)CC[C@H]6[C@H](C)C=5/C=C/2\N\1[Mg]n4c(\C=C\3/N=C(/C=C/1C(\C=O)=C\2\C)C(/C)=C/3/CC)c(C)c7c4\C(=C6/N=5)[C@@H](C(=O)OC)C7=O
|
Properties |
|
C54H70MgO6N4 |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
N verify (what is: Y/N?) |
Infobox references |
|
|
Chlorophyll d is a form of chlorophyll, identified by Harold Strain and Winston Manning in 1943.[1][2] It is present in marine red algae and cyanobacteria which use energy captured from sunlight for photosynthesis.[3] Chlorophyll d absorbs far-red light, at 710 nm wavelength, just outside the optical range.[4] An organism that contains chlorophyll d is adapted to an environment such as moderately deep water, where it can use far red light for photosynthesis,[5] although there is not a lot of visible light.[6]
| |
Ball-and-stick model | Space-filling model |
References