Chebulinic acid
Chebulinic acid
 |
| Names |
Other names
1,3,6-Tri-O-galloyl-2,4-chebuloyl-β-D-glucopyranoside [1] |
| Identifiers |
| |
18942-26-2  Y |
| ChEMBL |
ChEMBL501154  N |
InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,
50)/t14-,22+,24-,30-,31+,33-,34+,41-/m0/s1
Key: YGVHOSGNOYKRIH-FJPMMHPYSA-N
|
| Jmol-3D images |
Image |
| PubChem |
12401 |
C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O
|
| Properties |
| |
C41H32O27 |
| Molar mass |
956.67 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
| N verify (what is: Y/N?) |
| Infobox references |
|
|
Chebulinic acid is an ellagitannin found in the seeds of Euphoria longana, in the fruits of Terminalia chebula[2] or in the leaves of Terminalia macroptera.
References
- ↑ The structural and conformational analyses and antioxidant activities of chebulinic acid and its thrice-hydrolyzed derivative, 2,4-chebuloyl-β-D-glucopyranoside, isolated from the fruit of Terminalia chebula. Karel D. Klika, Ammar Saleem, Jari Sinkkonen, Marja Kähkönen, Jyrki Loponen, Petri Tähtinen and Kalevi Pihlaja, ARKIVOC 2004 (vii) 83-105
- ↑ Preparative isolation of hydrolysable tannins chebulagic acid and chebulinic acid from Terminalia chebula by high-speed counter-current chromatography. Quanbin Han, Jingzheng Song, Chunfeng Qiao, Lina Wong and Hongxi Xu, J. Sep. Sci. 2006, 29, pp. 1653–1657, doi:10.1002/jssc.20060008
|
|---|
| | Moieties | |
|---|
| | Lactones | |
|---|
| | Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
C-glycosidic ellagitannins | |
|---|
| | |
|---|
| Transformed ellagitannins | | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| | Oligomers | |
|---|
| | Other | |
|---|
|