Carasinol B
Carasinol B
|
Identifiers |
|
777857-86-0 Y |
ChemSpider |
9484024 N |
InChI=1S/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56+/m1/s1 NKey: RAUCCLKIJHMTND-HFRYPGABSA-N NInChI=1/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56+/m1/s1 Key: RAUCCLKIJHMTND-HFRYPGABBW
|
Jmol-3D images |
Image |
PubChem |
11309056 |
Oc1ccc(cc1)[C@@H]4Oc2cc(O)cc(c2[C@H]4c3cc(O)cc(O)c3)[C@H]6c7c(O[C@@H]6c5ccc(O)cc5)cc(O)cc7[C@@H]%10[C@H](c8cc(O)cc(O)c8)[C@H](O[C@H]%10c9ccc(O)cc9)c%11ccc(O)cc%11
|
Properties |
|
C56H44O13 |
Molar mass |
924.94 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
N verify (what is: Y/N?) |
Infobox references |
|
|
Carasinol B is a stilbenoid tetramer found in Caragana sinica (Chinese : Jin Que-gen).[1]
Acid-catalyzed epimerization of kobophenol A to carasinol B can be performed in vitro.[2]
References
|
---|
|
- Diptoindonesin C
- Diptoindonesin F
- Gnetin H
- Hemsleyanol D
- Isohopeaphenol
- Laetevirenol A, B, C, D and E
- Suffruticosol A and B
- Viniferal
- E-ω-viniferin
- Z-ω-viniferin
| | Dimers |
- Diptoindonesin G
- Jezonodione
- B
- Scirpusin A
- Tibeticanol (piceatannol dimer)
|
---|
| Trimers |
- Amurensin B
- Gnetin E
- Gneyulin A
- Johorenol A
- Ampelopsin E
- Vaticanol G
|
---|
| Tetramers: |
- Dibalanocarpol
- Gnetin J (3"-hydroxygnetin E)
- Gnetin K (3"-methoxygnetin E)
- Gnetuhainin R (isorhapontigenin tetramer)
- Laetevirenol F and G
|
---|
| Higher polymers (five units or more) | |
---|
| Oligomeric forms of resveratrol | Dimers | |
---|
| Trimers | |
---|
| Tetramers | |
---|
| Pentamers | |
---|
| Hexamers | |
---|
| Higher polymers |
- γ-viniferin
- Valeriaphenol A
|
---|
|
---|
| Glycosides or conjugates |
- Diptoindonesin A (C-glucoside of ε-viniferin)
- Foeniculoside I (glucoside of miyabenol C), II, III and IV
- Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
- Laevifoside (O-glucoside of ampelopsin A)
|
---|
|