Ampelopsin A

Ampelopsin A
Identifiers

CAS Registry Number	280561-81-1
Jmol-3D images	Image
SMILES Oc1ccc(cc1)C6c2c(cc(O)cc2O)C3c5c(cc(O)cc5OC3c4ccc(O)cc4)C6O
Properties
Chemical formula	C₂₈H₂₂O₇
Molar mass	470.47 g/mol
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa)
Infobox references

Ampelopsin A is a resveratrol dimer found in Ampelopsis brevipedunculata var hancei.^[1]^[2]

References

↑ Ampelopsins A, B and C, new oligostilbenes of Ampelopsis brevipedunculata VAR hancei. Yoshiteru Oshima, Yuji Ueno, Hiroshi Hikino, Yang Ling-Ling and Yen Kun-Ying, Tetrahedron, Volume 46, Issue 15, 1990, Pages 5121–5126, doi:10.1016/S0040-4020(01)87819-4
↑ Chemical determination of the absolute structures of resveratrol dimers, ampelopsins A, B, D and F. Yoshiaki Takaya, Ke-Xu Yan†, Kenji Terashima, Junko Ito and Masatake Niwa, Tetrahedron, Volume 58, Issue 36, 2 September 2002, Pages 7259–7265, doi:10.1016/S0040-4020(02)00785-8

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D

Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B

Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)

Pentamers	Amurensin E and F

Hexamers	Chunganenol

Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates