6,6'-Bieckol
6,6'-Bieckol
 |
| Names |
| IUPAC name
4-(3,5-dihydroxyphenoxy)-9-[6-(3,5-dihydroxyphenoxy)-2,4,7,9-tetrahydroxydibenzo-p-dioxin-1-yl]dibenzo-p-dioxin-1,3,6,8-tetrol |
| Identifiers |
| |
88095-81-2 |
| ChemSpider |
121062 |
InChI=1S/C36H22O18/c37-11-1-12(38)4-15(3-11)49-29-21(45)9-23(47)31-35(29)53-27-19(43)7-17(41)25(33(27)51-31)26-18(42)8-20(44)28-34(26)52-32-24(48)10-22(46)30(36(32)54-28)50-16-5-13(39)2-14(40)6-16/h1-10,37-48H
Key: HBJNTPFHQKXWOY-UHFFFAOYSA-N InChI=1/C36H22O18/c37-11-1-12(38)4-15(3-11)49-29-21(45)9-23(47)31-35(29)53-27-19(43)7-17(41)25(33(27)51-31)26-18(42)8-20(44)28-34(26)52-32-24(48)10-22(46)30(36(32)54-28)50-16-5-13(39)2-14(40)6-16/h1-10,37-48H
Key: HBJNTPFHQKXWOY-UHFFFAOYAE
|
| Jmol-3D images |
Image |
| PubChem |
137388 |
C1=C(C=C(C=C1O)OC2=C(C=C(C3=C2OC4=C(C=C(C(=C4O3)C5=C6C(=C(C=C5O)O)OC7=C(O6)C(=CC(=C7OC8=CC(=CC(=C8)O)O)O)O)O)O)O)O)O
|
| Properties |
| |
C36H22O18 |
| Molar mass |
742.55 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
|
| Infobox references |
|
|
6,6'-Bieckol is an eckol-type phlorotannin found in the brown algae Ecklonia cava[1] and Ecklonia stolonifera.[2]
References
- ↑ Artan, M.; Li, Y.; Karadeniz, F.; Lee, S. H.; Kim, M. M.; Kim, S. K. (2008). "Anti-HIV-1 activity of phloroglucinol derivative, 6,6′-bieckol, from Ecklonia cava". Bioorganic & Medicinal Chemistry 16 (17): 7921–7926. doi:10.1016/j.bmc.2008.07.078. PMID 18693022.
- ↑ Lee, M. S.; Shin, T.; Utsuki, T.; Choi, J. S.; Byun, D. S.; Kim, H. R. (2012). "Isolation and Identification of Phlorotannins from Ecklonia stolonifera with Antioxidant and Hepatoprotective Properties in Tacrine-Treated HepG2 Cells". Journal of Agricultural and Food Chemistry 60 (21): 5340–5349. doi:10.1021/jf300157w. PMID 22587607.
|
|---|
| | Monomer | |
|---|
| | Fucols | |
|---|
| | Phlorethols |
- Diphlorethol and diphlorethol A
- Triphloroethol A
- Tetraphlorethol A, B, C and E
- Pentaphlorethol-B
- Hexaphlorethol-A
|
|---|
| | Fucophlorethols |
- Fucophlorethol A and B
- Fucodiphlorethol A, D and G
- Fucotriphlorethol-B, G and H
- Fucotetraphlorethol-B, J and K
- Fucopentaphlorethol-E
- Bisfucotriphlorethol-A
- Bisfucotetraphlorethol-A
- Bisfucopentaphlorethol-A and B
- Bisfucoheptaphlorethol-A
- Difucophlorethol-A
- Difucofucotriphlorethol-A and B
- Difucofucotetraphlorethol-A
- Terfucopentaphlorethol-A
- Terfucohexaphlorethol-A and B
- Terfucoheptaphlorethol-A
|
|---|
| | Fuhalols | |
|---|
| | Isofuhalols | |
|---|
| | Eckols | |
|---|
| | Halogenated phlorotannins | Bromotriphlorethol A1 |
|---|
|