4-Methoxyresveratrol
4-Methoxyresveratrol
![Chemical structure of 4-methoxyresveratrol](../I/m/4-Methoxyresveratrol.png) |
Names |
IUPAC name
5-[(E)-2-(4-Methoxyphenyl)vinyl]-1,3-benzenediol |
Other names
4'-Methoxyresveratrol Deoxyrhapontigenin desoxyrhapontigenin |
Identifiers |
|
33626-08-3 |
ChemSpider |
4863932 |
Jmol-3D images |
Image |
COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)O)O
|
Properties |
|
C15H14O3 |
Molar mass |
242.27 g/mol |
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa) |
Infobox references |
|
|
4-Methoxyresveratrol is a stibenoid found in the Chinese herb Gnetum cleistostachyum.[1]
References
- ↑ Stilbenes from Gnetum cleistostachyum. Yao Chun-Suo, Lin Mao, Liu Xin and Wangy Ying-Hong, Huaxue xuebao, 2003, vol. 61, no 8, pages 1331-1334,
INIST:15332136
Hydroxystilbenes and their glycosides (monomeric forms) |
---|
| Dihydroxylated | |
---|
| Trihydroxylated | |
---|
| Tetrahydroxylated | |
---|
| O-methylated | |
---|
| carboxylated | |
---|
| other acylations | |
---|
| Glycosides | | | of resveratrol | |
---|
| of rhapontigenin |
- Rhapontigenin 3-O-rutinoside
- 4'-Methoxy-(E)-resveratrol 3-O-rutinoside
- Rhaponticin (Rhapontigenin glucoside)
|
---|
|
|
---|
| Oligomeric forms | |
---|
|