(2,4,6-Trimethylphenyl)gold

(2,4,6-Trimethylphenyl)gold

Names
IUPAC name (2,4,6-Trimethylphenyl)gold
Other names Mesitylgold Mesitylgold(I) (2,4,6-Trimethylphenyl)gold(I)
Identifiers
CAS Registry Number	89359-21-7 monomer N 89340-02-3 pentamer Y
ChemSpider	14451398 Y
InChI InChI=1S/C9H11.Au/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3; Y Key: VUMCLWYYCJSHBH-UHFFFAOYSA-N Y
Jmol-3D images	Image Image
PubChem	19877937
SMILES Cc1cc(C)c([Au])c(C)c1 CC1=CC(C)=C([Au])C(C)=C1
Properties
Chemical formula	Au 5C 45H 55
Molar mass	316.15 g mol−1
Except where noted otherwise, data is given for materials in their standard state (at 25 °C (77 °F), 100 kPa)
N verify (what is: Y/N?)
Infobox references

(2,4,6-Trimethylphenyl)gold is a member of a special group of compounds where an aryl carbon atom acts as a bridge between two gold atoms. This compound is formed in a reaction between Au(CO)Cl and mesityl Grignard.^[1] It crystallizes as a cyclical pentamer.^[1]

References