Pinosylvin

Pinosylvin

IUPAC name 5-[(E)-2-Phenylethenyl]benzene-1,3-diol
Other names (E)-3,5-Stilbenediol trans-3,5-Dihydroxystilbene
Identifiers
CAS number	102-61-4^Y
PubChem	5280457
ChEMBL	CHEMBL101506^N
Jmol-3D images	Image 1
SMILES C1=CC=C(C=C1)\C=C\C2=CC(=CC(=C2)O)O
Properties
Molecular formula	C₁₄H₁₂O₂
Molar mass	212.244 g/mol
Exact mass	212.08373 u
Melting point	153–155 °C
N (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Pinosylvin is a pre-infectious stilbenoid toxin (i.e. synthesized prior to infection), contrary to phytoalexins which are synthesized during infection. It is present in the heartwood of Pinaceae. It is a fungitoxin protecting the wood from fungal infection.

See also

Pinosylvin synthase

Stilbenoids and their glycosides

Combretastatin | Combretastatin A-1 | Combretastatin A-4 | Combretastatin B-1 | Piceatannol | Pinosylvin | Pterostilbene | Resveratrol

Astringin | Rhaponticin

of resveratrol	Piceid \| Trans-resveratrol-3-O-glucuronide

Oligomeric forms

Ampelopsin A | Amurensin A, B, G and H | Carasinol B | Diptoindonesin C | Diptoindonesin F | Flexuosol A | Gnetin H | Hemsleyanol D | Kobophenol A | Laetevirenol A, B, C, D and E | Vaticanol B | Viniferal | Tetramers : Laetevirenol F and G

of resveratrol	Ampelopsin E \| Dimers : ε-viniferin, Parthenocissin A, Quadrangularin A, Pallidol and Amurensin A \| Trimers : α-viniferin, Laevifonol (an ε-viniferin-ascorbic acid hybrid compound), Malaysianol A, trans-diptoindonesin B \| Tetramers : Hopeaphenol \| Vitisins A, B and C

Oligomeric forms glycosides

Diptoindonesin A | Laevifoside (O-glucoside of ampelopsin A)

Misc

Hydroxystilbamidine | Alpha-Phenylcinnamic acid

Synthetic

Stilbenoid drugs