BSTFA

BSTFA

IUPAC name N,O-Bis(trimethylsilyl)trifluoroacetamide
Other names BSTFA
Identifiers
CAS number	25561-30-2
PubChem	94358
ChemSpider	4518443^Y
Jmol-3D images	Image 1
SMILES C[Si](C)(C)O\C(\C(F)(F)F)=N\[Si](C)(C)C
InChI InChI=1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+^Y Key: XCOBLONWWXQEBS-KPKJPENVSA-N^Y InChI=1/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ Key: XCOBLONWWXQEBS-KPKJPENVBV
Properties
Molecular formula	C₈H₁₈F₃NOSi₂
Molar mass	257.4 g mol⁻¹
Y (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

N,O-Bis(trimethylsilyl)trifluoroacetamide (BSTFA) is a chemical compound which is used to derivitise labile groups such as hydroxyl on other chemicals, with the more stable trimethylsilyl group, which protects the labile group and allows the compound to be used for analytical purposes or as a chemical reagent for synthesis of more complex molecules.^[1]

References

^ Stalling DL, Gehrke CW, Zumwalt RW. A new silylation reagent for amino acids bis(trimethylsilyl)trifluoroacetamide (BSTFA). Biochemical and Biophysical Research Communications. 1968 May 23;31(4):616-22. PMID 5656249