Trimesic acid
From Wikipedia, the free encyclopedia
Trimesic acid | |
---|---|
IUPAC name | benzene-1,3,5-tricarboxylic acid |
Identifiers | |
CAS number | [554-95-0] |
PubChem | |
EINECS number | |
SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)O |
Properties | |
Molecular formula | C9H6O6 |
Molar mass | 210.14034 |
Hazards | |
MSDS | Oxford MSDS |
R-phrases | R36 R37 R38 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Trimesic acid, formally known as benzene-1,3,5-tricarboxylic acid, is a benzene derivative with three carboxylic acid groups.