Theaflavin-3-gallate
From Wikipedia, the free encyclopedia
| Theaflavin-3-gallate | |
|---|---|
 |
|
| IUPAC name | [(2R,3R)-5,7-dihydroxy-2-[3,4,5-trihydroxy-6-oxo-8-[(2R,3R)-3,5,7-trihydroxychroman-2-yl]benzo[7]annulen-1-yl]chroman-3-yl] 3,4,5-trihydroxybenzoate |
| Identifiers | |
| CAS number | [28543-07-9] |
| PubChem | |
| SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=O)C(=C4C(=C3)C(=CC(=C4O)O)[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O |
| Properties | |
| Molecular formula | C36H28O16 |
| Molar mass | 716.598 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Theaflavin-3-gallate is a theaflavin derivative.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
