Sulforhodamine B

From Wikipedia, the free encyclopedia

Sulforhodamine B
(+)-Quassin
IUPAC name 2-(3-diethylamino-6-diethylazaniumylidene-xanthen-9-yl)-5-sulfo-benzenesulfonate
EINECS number 220-025-2
Identifiers
CAS number [3520-42-1]
PubChem 65191
SMILES O=S(=O)(O)c4ccc(C=1c3c(OC=2C=1\C=C/C(=[N+](/CC)CC)/C=2)cc(cc3)N(CC)CC)c(c4)S([O-])(=O)=O
InChI key IOOMXAQUNPWDLL-UHFFFAOYAJ
Properties
Molecular formula C27H30N2O7S2
Molar mass 558.6663 g/mol
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references

Sulforhodamine B or Kiton Red (C27H30N2O7S2; Molecular Weight 558.66 grams/mole) is a fluorescent dye with uses spanning from L.I.F.(Laser Induced Fluorescense) to the quantification of cellular proteins of cultured cells. The red, solid, water soluble dye is primarily used as a polar tracer.

The dye absorbs 565nm light and emits 586nm light. It does not exhibit pH dependent absorption or fluorescence over the range of 3 to 10[1].


[edit] References

  1. ^ Coppeta, Rogers (1998). "Dual Emission Laser Induced Fluorescence for Direct Planar Scalar Behavior Measurements". Experiments in Fluids: 1-15;. doi:10.1007/s003480050202. 
 This article about an organic compound is a stub. You can help Wikipedia by expanding it.