Saccharic acid
From Wikipedia, the free encyclopedia
Saccharic acid | |
---|---|
![]() |
|
IUPAC name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
Other names | Glucaric acid |
Identifiers | |
CAS number | |
PubChem | |
SMILES | C(C(C(C(=O)O)O)O)(C(C(=O)O)O)O |
Properties | |
Molecular formula | C6H10O8 |
Molar mass | 210.1388 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Saccharic acid, also called glucaric acid, is a chemical compound with the formula C6H10O8. It is derived by oxidizing a sugar such as glucose with nitric acid.[1]
[edit] References
- ^ Saccharic acid at Merriam-Webster's Medical Dictionary