Ranelic acid
From Wikipedia, the free encyclopedia
| Ranelic acid | |
|---|---|
 |
|
| IUPAC name | 5-(Bis(carboxymethyl)amino)-3-(carboxymethyl)-4-cyano-2-thiophenecarboxylic acid |
| Identifiers | |
| CAS number | [5459-90-4] |
| PubChem | |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)O)CC(=O)O)C(=O)O)C(=O)O |
| Properties | |
| Molecular formula | C12H10N2O8S |
| Molar mass | 342.28 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ranelic acid is an organic acid capable of chelating metal cations.
Strontium ranelate, made by combining strontium(II) with ranelic acid, is an experimental drug used to treat osteoporosis and increase bone mineral density (BMD).
 |
This organic chemistry article is a stub. You can help Wikipedia by expanding it. |
