Queuine
From Wikipedia, the free encyclopedia
| Queuine | |
|---|---|
 |
|
| Identifiers | |
| CAS number | [72496-59-4] |
| PubChem | |
| MeSH | |
| SMILES | C1=CC(C(C1NCC2=C3C(=NC(=NC3=O)N)N=C2)O)O |
| Properties | |
| Molecular formula | C12H13N5O3 |
| Molar mass | 275.264 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Queuine (Q) (7-(((4,5-cis-dihydroxy-2-cyclopenten-1-yl)amino)methyl)- 7-deazaguanosine) is a hypermodified base found in the first (or wobble) position of the anticodon of tRNAs specific for Asn, Asp, His, and Tyr, in most prokaryotes and eubacteria. The nucleoside of queuine is queuosine.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
