Phytane
From Wikipedia, the free encyclopedia
| Phytane | |
|---|---|
 |
|
| IUPAC name | 2,6,10,14-tetramethylhexadecane |
| Identifiers | |
| CAS number | [638-36-8] |
| PubChem | |
| SMILES | CC(CC)CCCC(C)CCCC(C)CCCC(C)C |
| InChI key | GGYKPYDKXLHNTI-UHFFFAOYAM |
| Properties | |
| Molecular formula | C20H42 |
| Molar mass | 282.55 |
| Density | 0.791 g/mL at 20 °C |
| Boiling point |
69-71 °C (0.001 Torr) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Phytane is a diterpenoid alkane. In contrast to pristane, which is formed from the decarboxylation of phytol, it has one extra carbon.
Phytene is the unsaturated version of phytane. Phytene is also found as the functional group phytyl in many organic molecules of biological importance such as chlorophyll, tocopherol (Vitamin E) and phylloquinone (Vitamin K2). Phytene's corresponding alcohol is phytol.
Caldarchaeol a compound found in cell memranes contains of two fused phytene chains.
 |
This article about a hydrocarbon is a stub. You can help Wikipedia by expanding it. |
| International Chemical Identifier | |
|---|---|
| InChI= | 1/C20H42/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h17-20H,7-16H2,1-6H3 |
| InChIKey= | |
| CASRN= | |
| PIN= | |
