Phenylacetylglutamine
From Wikipedia, the free encyclopedia
| Phenylacetylglutamine | |
|---|---|
 |
|
| IUPAC name | 5-amino-5-oxo-2- [(1-oxo-2-phenylethyl)amino]pentanoic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC=C(C=C1)CC(=O)NC(CCC(=O)N)C(=O)O |
| Properties | |
| Molecular formula | C13H16N2O4 |
| Molar mass | 264.277 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Phenylacetylglutamine is a product formed by the conjugation of phenylacetate and glutamine.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
Not sited in the literature
