Perosamine
From Wikipedia, the free encyclopedia
| Perosamine | |
|---|---|
 |
|
| IUPAC name | (2S,3S,4R,5R)-4-Amino-2,3,5-trihydroxyhexanal |
| Other names | 4-Amino-4,6-dideoxy-D-mannose |
| Identifiers | |
| CAS number | [31348-80-8] |
| PubChem | |
| SMILES | C[C@H]([C@H]([C@@H]([C@@H](C=O)O)O)N)O |
| Properties | |
| Molecular formula | C6H13NO4 |
| Molar mass | 163.172 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Perosamine is a 4-aminodeoxysugar that is found in the O-antigen of Vibrio cholarae O1 and E. coli O157:H7. Its biosynthesis from mannose follows a pathway similar to that of colitose, but is different in that it is aminated and does not undergo a C-5 epimerization.[1]
The final enzyme in the pathway, GDP-D-perosamine synthase, is a PLP-dependent enzyme that transfers an amino group from glutamate to the C-4 position of the sugar.
[edit] References
- ^ Albermann C, Piepersberg W. "Expression and identification of the RfBE protein from Vibrio cholerae O1 and its use for the enzymatic synthesis of GDP-D-perosamine." Glycobiology (2001) 11:655-661.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
