Octabenzone
From Wikipedia, the free encyclopedia
Octabenzone | |
---|---|
IUPAC name | (2-hydroxy-4-octoxy-phenyl)-phenyl-methanone |
Other names | Benzophenone-12, Spectra-Sorb UV 531 |
Identifiers | |
CAS number | [1843-05-6] |
PubChem | |
MeSH | |
SMILES | CCCCCCCCOC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
Properties | |
Molecular formula | C21H26O3 |
Molar mass | 326.429 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Octabenzone (Spectra-Sorb UV 531, C21H26O3) is a UV absorber/screener. It's used to protect polymers (e.g., polyethylene, polypropylene, polyvinylchloride) against damage by UV light.