Normelatonin
From Wikipedia, the free encyclopedia
Normelatonin | |
---|---|
IUPAC name | N-[2-(5-hydroxy-1H-indol-3-yl) ethyl]acetamide |
Identifiers | |
CAS number | [1210-83-9] |
PubChem | |
MeSH | |
SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)O |
Properties | |
Molecular formula | C12H14N2O2 |
Molar mass | 218.252 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Normelatonin also called N-acetylserotonin, is an intermediate in the production of melatonin from serotonin.
|
|