Norfenfluramine
From Wikipedia, the free encyclopedia
| Norfenfluramine | |
|---|---|
 |
|
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]propan-2-amine |
| Identifiers | |
| CAS number | [242-769-7] |
| PubChem | |
| SMILES | CC(CC1=CC(=CC=C1)C(F)(F)F)N |
| Properties | |
| Molecular formula | C10H12F3N |
| Molar mass | 203.204 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Norfenfluramine is a serotonin uptake inhibitor.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
