Nitrofurazone
From Wikipedia, the free encyclopedia
| Nitrofurazone | |
|---|---|
 |
|
| IUPAC name | [(5-nitro-2-furyl)methyleneamino]urea |
| Identifiers | |
| CAS number | [59-87-0] |
| PubChem | |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C=NNC(=O)N |
| Properties | |
| Molecular formula | C6H6N4O4 |
| Molar mass | 198.136 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Nitrofurazone, 2-((5-nitro-2-furanyl)methylene)hydrazinecarboxamide, chemical formula C6H6N4O4, is a pale yellow crystalline compound.
This bactericidal compound is used as an antibiotic most commonly in the form of ointments. Its use in medicine has become less frequent as safer and more effective products have become available.
Other names for this chemical include nitrofural and furacilin.
 |
This antibiotic-related article is a stub. You can help Wikipedia by expanding it. |
