N-Acetyltalosaminuronic acid
From Wikipedia, the free encyclopedia
N-Acetyltalosaminuronic acid | |
---|---|
![]() |
|
IUPAC name | (2R,3S,4S,5R,6R)-5-acetamido-3,4,6- trihydroxyoxane-2-carboxylic acid |
Other names | Talanac; α-L-N-Acetyltalosaminuronic acid; α-L-2-N-Acetylamino-2-desoxytaluronic acid; α-L-Talopyranuronic acid, 2-(acetylamino)-2-deoxy-, (5Z,11alpha,13E,15S)-; NAT |
Identifiers | |
CAS number | [90319-06-5] |
PubChem | |
MeSH | |
SMILES | CC(=O)N[C@@H]1[C@@H]([C@@H]([C@@H](O[C@H]1O)C(=O)O)O)O |
Properties | |
Molecular formula | C8H13NO7 |
Molar mass | 235.19132 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
N-Acetyltalosaminuronic acid is a uronic acid. It is a component of pseudopeptidoglycan, a structural polymer found in the cell walls in some types of Archaea.