Mesulergine
From Wikipedia, the free encyclopedia
Mesulergine | |
---|---|
IUPAC name | N'-(1,6-Dimethylergolin-8alpha-yl)-N,N-dimethylsulfamide |
Other names | CQ-32085 |
Identifiers | |
CAS number | [72786-12-0] |
PubChem | |
MeSH | |
SMILES | Cn1cc(C[C@]2([H])[C@]3([H])C[C@H](CN([H])S(N(C)C)(=O)=O)CN2C)c4c3cccc41 |
Properties | |
Molecular formula | C18H26N4O2S |
Molar mass | 362.49 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Mesulergine is a synthetic compound, that acts on subsets of both 5-HT receptors and dopamine receptors.