Isocitric acid

From Wikipedia, the free encyclopedia

Isocitric acid
IUPAC name	1-Hydroxypropane-1,2,3-tricarboxylic acid
Identifiers
CAS number	[320-77-4]
PubChem	1198
MeSH	Isocitrate
SMILES	C(C(C(C(=O)O)O)C(=O)O)C(=O)O
Properties
Molecular formula	C6H8O7
Molar mass	192.12 g mol-1
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references

Isocitric acid is a protonated form of isocitrate, which is a substrate of the citric acid cycle. Isocitrate is formed from citrate with the help of the enzyme aconitase, and is acted upon by isocitrate dehydrogenase. Salts and esters of isocitric acid are known as isocitrates.

v • d • e Citric Acid Cycle Metabolic Pathway
Oxaloacetate Malate Fumarate Succinate Succinyl-CoA Acetyl-CoA NADH + H+ NAD+ H2O FADH2 FAD CoA + ATP(GTP) Pi + ADP(GDP) + H2O NADH + H+ + CO2 CoA NAD+ H2O H2O NAD(P)+ NAD(P)H + H+ CO2 Citrate cis-Aconitate Isocitrate Oxalosuccinate α-Ketoglutarate