Grapefruit mercaptan
From Wikipedia, the free encyclopedia
| Grapefruit mercaptan | |
|---|---|
 |
 |
| IUPAC name | (R)-2-(4-methylcyclohex-3-enyl)propane-2-thiol |
| Other names | grapefruit mercaptan 1-p-methene-8-thiol α,α,4-trimethylcyclohex-3-ene-1-methane thiol thioterpineol |
| Identifiers | |
| CAS number | racemate: 71159-90-5 R isomer: 83150-78-1 |
| SMILES | CC1=CC[C@H]([C@](C)(S)C)CC1 |
| Properties | |
| Molecular formula | C10H18S |
| Molar mass | 170.31 g/mol |
| Density | 1.03 g/cm3 |
| Melting point |
<25 °C |
| Boiling point |
58 °C at .33 mmHg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Grapefruit mercaptan is the common name for a natural organic compound found in grapefruit. It is a monoterpenoid that contains a thiol (or mercaptan) functional group. Structurally a hydroxy group of terpineol is replaced by the thiol in grapefruit mercaptan, so it also called thioterpineol. Volatile thiols typically have very strong, often unpleasant odors which can be detected by humans in very low concentrations. Grapefruit mercaptan has a very potent, but not unpleasant, odor and it is the chemical constituent primarily responsible for the aroma of grapefruit.[1] This characteristic aroma is a property of only the R-stereoisomer.[2]
Pure grapefruit mercaptan, or citrus-derived oils rich in grapefruit mercaptan, are sometimes used in perfumery and the flavor industry to impart citrus aromas and flavors. However, both industries actively seek substitutes for grapefruit mercaptans for use as a grapefruit flavorant, since its decomposition products are often highly disagreeable to the human sense of smell.
[edit] References
- ^ Buettner A., Schieberle P. (1999). "Characterization of the Most Odor-Active Volatiles in Fresh, Hand-Squeezed Juice of Grapefruit (Citrus paradisi Macfayden)". J. Agric. Food Chem. 47 (12): 5189–5193. doi:.
- ^ Lehmann D., Dietrich A., Hener U., Mosandl A. (1994). "Stereoisomeric flavor compounds. LXX: 1-p-menthene-8-thiol: separation and sensory evaluation of the enantiomers by enantioselective gas chromatography-olfactometry". Phytochemical Analysis 6 (5): 255–257. doi:.
