Grandisol
From Wikipedia, the free encyclopedia
| Grandisol | |
|---|---|
 |
|
| IUPAC name | (+)-(1R,2S)-1-(2'-Hydroxyethyl)-1-methyl- 2-isopropenylcyclobutane |
| Other names | cis-2-Isopropenyl-1-methylcyclobutaneethanol |
| Identifiers | |
| CAS number | [28117-21-7] |
| SMILES | CC([C@]1([H])CC[C@@](C)1CCO)=C |
| Properties | |
| Molecular formula | C10H18O |
| Molar mass | 154.25 g/mol |
| Melting point |
<25 °C |
| Boiling point |
50-60 °C at 1 mmHg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Grandisol is a natural organic compound with the molecular formula C10H18O. It is a monoterpene containing a cyclobutane ring, an alcohol group, an alkene group and two chiral centers.
Grandisol is a pheromone primarily important as the sex attractant of the cotton boll weevil (Anthonomus grandis), from which it gets its name. It is also a pheromone for other related insects. The cotton boll weevil is an agricultural pest that can cause significant economic damage if not controlled. Grandisol is the major constituent of the mixture known as grandlure, which is used to protect cotton crops from the boll weevil.
[edit] References
 |
The references in this article would be clearer with a different or consistent style of citation, footnoting, or external linking. |
- Merck Index, 11th Edition, 4442.
