Fucose (data page)
From Wikipedia, the free encyclopedia
The complete data for Fucose | ||||||||||||||||
General information Chemical formula: C6H12O5
Molar mass: 164.16 g·mol-1 Systematic name: (3S,4R,5R,6S)-6-methyloxane-2,3,4,5-tetrol Abbreviations: Fuc Synonyms: 6-deoxy-L-galactose 6-deoxy-L-galactopyranose 6-methyltetrahydropyran-2,3,4,5-tetraol L-fucopyranose |
||||||||||||||||
Database data | ||||||||||||||||
SMILES: C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)O)O)O InChI=1/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6?/m0/s1
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |