Fructose-1-phosphate
From Wikipedia, the free encyclopedia
Fructose-1-phosphate | |
---|---|
IUPAC name | [2,3,4-Trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxyphosphonic acid |
Identifiers | |
CAS number | [15978-08-2] |
PubChem | |
MeSH | |
SMILES | C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)O |
Properties | |
Molecular formula | C6H13O9P |
Molar mass | 260.136 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Fructose-1-phosphate is a derivative of fructose. It is generated by hepatic fructokinase.
It is converted by aldolase B into glyceraldehyde and dihydroxyacetone phosphate (DHAP).