FC-75
From Wikipedia, the free encyclopedia
| FC-75 | |
|---|---|
 |
|
| IUPAC name | 2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)tetrahydrofuran |
| Other names | Fluorinert FC-75, Perfluoro-compound FC-75, Perfluoro-2-n-butyl THF, Perfluoro(butyltetrahydrofuran) |
| Abbreviations | PFBTHF |
| Identifiers | |
| CAS number | [335-36-4] |
| PubChem | |
| EINECS number | |
| SMILES | C1(C(C(OC1(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(F)F |
| Properties | |
| Molecular formula | C8F16O |
| Molar mass | 416.06 |
| Melting point |
-88 °C, 185 K, -126 °F |
| Boiling point |
102 °C, 375 K, 216 °F |
| Solubility in water | Insoluble |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
FC-75 is a perfluorocarbon derivate of tetrahydrofuran with the chemical formula C8F16O. It is practically insoluble in water.
It is one of the 3M Fluorinert fluids. It is used as an inert coolant fluid in electronics and other applications, and as a solvent.
A similar perfluoro coolant and solvent is perfluorohexane.
 |
This article about an organic halide is a stub. You can help Wikipedia by expanding it. |
