D-Galacturonic acid
From Wikipedia, the free encyclopedia
| D-Galacturonic acid | |
|---|---|
 |
|
| IUPAC name | (2S,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid |
| Identifiers | |
| CAS number | [685-73-4] |
| PubChem | |
| EINECS number | |
| SMILES | C(=O)[C@@H]([C@H]([C@H]([C@@H](C(=O)O)O)O)O)O |
| Properties | |
| Molecular formula | C6H10O7 |
| Molar mass | 194.139 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
D-Galacturonic acid is a sugar acid, an oxidized form of D-galactose. It is the main component of pectin, in which it exists as the polymer polygalacturonic acid. It has an aldehyde group at C1 and a carboxylic acid group at C6. Other oxidized forms of D-galactose are D-galactonic acid (carboxylic group at C1) and meso-galactaric acid (mucic acid) (carboxylic groups at C1 and C6)
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
