Chlorfenvinphos
From Wikipedia, the free encyclopedia
| Chlorfenvinphos | |
|---|---|
 |
|
| IUPAC name | Phosphoric acid [(E)-2-chloro-1-(2,4-dichlorophenyl)vinyl] diethyl ester |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CCOP(=O)(OCC)OC(=CCl)C1=C(C=C(C=C1)Cl)Cl |
| Properties | |
| Molecular formula | C12H14Cl3O4P |
| Molar mass | 359.57 g/mol |
| Appearance | Amber liquid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chlorfenvinphos is an insecticide. It is a colorless or amber liquid.
The United States cancelled use of chlorfenvinphos in 1991 because it is dangerous to humans. The substance has harmful effects on the nervous system. Chlorfenvinphos has not been classified for carcinogenicity (ability to cause cancer). Chlorfenvinphos was sold under five main brand names: Birlane, Dermaton, Sapercon, Steladone, and Supona.
[edit] Chemistry
A vinyl organophosphate, chlorfenvinphos hydroyzes in water slowly and isn't very soluble in that liquid. The chemical formula for chlorfenvinphos is C12H14Cl3O4P. Its molecular weight is 359.56.
