Carbadox
From Wikipedia, the free encyclopedia
| Carbadox | |
|---|---|
 |
|
| IUPAC name | methyl (2E)-2-[(1,4-dioxidoquinoxalin-2-yl) methylene]hydrazinecarboxylate |
| Identifiers | |
| CAS number | [6804-07-5] |
| PubChem | |
| EINECS number | |
| RTECS number | FE2779000 |
| SMILES | COC(=O)N\N=C\c2c[n+]([O-])c1ccccc1[n+]2[O-] |
| Properties | |
| Molecular formula | C11H10N4O4 |
| Molar mass | 262.22 g/mol |
| Appearance | Yellow crystals |
| Density | 1.44 g/cm3 |
| Melting point |
239.5 °C |
| Solubility in water | Insoluble |
| Hazards | |
| EU classification | F, T |
| R/S statement | R: R45, R11, R22 S: S53, S45 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Carbadox is a drug that combats parasite infection. In early 2004 it was banned by the Canadian government as a livestock feed additive and for human consumption. The European Union also forbids the use of Carbadox at any level. It is approved in the United States for use in swine for up to 42 days before slaughter.
[edit] External links
 |
This antimicrobial-related article is a stub. You can help Wikipedia by expanding it. |
